C13H12N2O5S2 — CID 2620159
(2-amino-2-oxoethyl) 2-(thiophen-2-ylsulfonylamino)benzoate (PubChem CID 2620159) has the molecular formula C13H12N2O5S2 and a molecular weight of 340.38 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) 2-(thiophen-2-ylsulfonylamino)benzoate.
| Compound Name | (2-amino-2-oxoethyl) 2-(thiophen-2-ylsulfonylamino)benzoate |
|---|---|
| PubChem CID | 2620159 |
| Molecular Formula | C13H12N2O5S2 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | (2-amino-2-oxoethyl) 2-(thiophen-2-ylsulfonylamino)benzoate |
| SMILES | NC(=O)COC(=O)c1ccccc1NS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C13H12N2O5S2/c14-11(16)8-20-13(17)9-4-1-2-5-10(9)15-22(18,19)12-6-3-7-21-12/h1-7,15H,8H2,(H2,14,16) |
| InChIKey | HAAUKVTWNKYPCA-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |