C18H21N3O7S3 — CID 24530687
[2-(4-methylsulfonylpiperazin-1-yl)-2-oxoethyl] 2-(thiophen-2-ylsulfonylamino)benzoate (PubChem CID 24530687) has the molecular formula C18H21N3O7S3 and a molecular weight of 487.58 g/mol. Its IUPAC name is [2-(4-methylsulfonylpiperazin-1-yl)-2-oxoethyl] 2-(thiophen-2-ylsulfonylamino)benzoate.
| Compound Name | [2-(4-methylsulfonylpiperazin-1-yl)-2-oxoethyl] 2-(thiophen-2-ylsulfonylamino)benzoate |
|---|---|
| PubChem CID | 24530687 |
| Molecular Formula | C18H21N3O7S3 |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.05 |
| IUPAC Name | [2-(4-methylsulfonylpiperazin-1-yl)-2-oxoethyl] 2-(thiophen-2-ylsulfonylamino)benzoate |
| SMILES | CS(=O)(=O)N1CCN(C(=O)COC(=O)c2ccccc2NS(=O)(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C18H21N3O7S3/c1-30(24,25)21-10-8-20(9-11-21)16(22)13-28-18(23)14-5-2-3-6-15(14)19-31(26,27)17-7-4-12-29-17/h2-7,12,19H,8-11,13H2,1H3 |
| InChIKey | LGANMHUDKMQDPB-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 130.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |