C18H22N2O5S2 — CID 2620113
[2-oxo-2-(pentan-3-ylamino)ethyl] 2-(thiophen-2-ylsulfonylamino)benzoate (PubChem CID 2620113) has the molecular formula C18H22N2O5S2 and a molecular weight of 410.52 g/mol. Its IUPAC name is [2-oxo-2-(pentan-3-ylamino)ethyl] 2-(thiophen-2-ylsulfonylamino)benzoate.
| Compound Name | [2-oxo-2-(pentan-3-ylamino)ethyl] 2-(thiophen-2-ylsulfonylamino)benzoate |
|---|---|
| PubChem CID | 2620113 |
| Molecular Formula | C18H22N2O5S2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | [2-oxo-2-(pentan-3-ylamino)ethyl] 2-(thiophen-2-ylsulfonylamino)benzoate |
| SMILES | CCC(CC)NC(=O)COC(=O)c1ccccc1NS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C18H22N2O5S2/c1-3-13(4-2)19-16(21)12-25-18(22)14-8-5-6-9-15(14)20-27(23,24)17-10-7-11-26-17/h5-11,13,20H,3-4,12H2,1-2H3,(H,19,21) |
| InChIKey | MCXSHBQEJJWRER-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |