C16H18N2O5S2 — CID 7247664
[2-oxo-2-[[(1R)-1-thiophen-2-ylethyl]amino]ethyl] 2-(methanesulfonamido)benzoate (PubChem CID 7247664) has the molecular formula C16H18N2O5S2 and a molecular weight of 382.46 g/mol. Its IUPAC name is [2-oxo-2-[[(1R)-1-thiophen-2-ylethyl]amino]ethyl] 2-(methanesulfonamido)benzoate.
| Compound Name | [2-oxo-2-[[(1R)-1-thiophen-2-ylethyl]amino]ethyl] 2-(methanesulfonamido)benzoate |
|---|---|
| PubChem CID | 7247664 |
| Molecular Formula | C16H18N2O5S2 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | [2-oxo-2-[[(1R)-1-thiophen-2-ylethyl]amino]ethyl] 2-(methanesulfonamido)benzoate |
| SMILES | C[C@@H](NC(=O)COC(=O)c1ccccc1NS(C)(=O)=O)c1cccs1 |
| InChI | InChI=1S/C16H18N2O5S2/c1-11(14-8-5-9-24-14)17-15(19)10-23-16(20)12-6-3-4-7-13(12)18-25(2,21)22/h3-9,11,18H,10H2,1-2H3,(H,17,19)/t11-/m1/s1 |
| InChIKey | UOOXDJSBTDXITD-LLVKDONJSA-N |
| XLogP | 2.15 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |