C15H13ClFNO3S — CID 8624862
[2-oxo-2-[[(1S)-1-thiophen-2-ylethyl]amino]ethyl] 5-chloro-2-fluorobenzoate (PubChem CID 8624862) has the molecular formula C15H13ClFNO3S and a molecular weight of 341.79 g/mol. Its IUPAC name is [2-oxo-2-[[(1S)-1-thiophen-2-ylethyl]amino]ethyl] 5-chloro-2-fluorobenzoate.
| Compound Name | [2-oxo-2-[[(1S)-1-thiophen-2-ylethyl]amino]ethyl] 5-chloro-2-fluorobenzoate |
|---|---|
| PubChem CID | 8624862 |
| Molecular Formula | C15H13ClFNO3S |
| Molecular Weight | 341.79 g/mol |
| Exact Mass | 341.03 |
| IUPAC Name | [2-oxo-2-[[(1S)-1-thiophen-2-ylethyl]amino]ethyl] 5-chloro-2-fluorobenzoate |
| SMILES | C[C@H](NC(=O)COC(=O)c1cc(Cl)ccc1F)c1cccs1 |
| InChI | InChI=1S/C15H13ClFNO3S/c1-9(13-3-2-6-22-13)18-14(19)8-21-15(20)11-7-10(16)4-5-12(11)17/h2-7,9H,8H2,1H3,(H,18,19)/t9-/m0/s1 |
| InChIKey | WNYATWBDWDYJEU-VIFPVBQESA-N |
| XLogP | 3.57 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.79 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |