C15H14BrNO4S — CID 8022071
[2-oxo-2-[[(1R)-1-thiophen-2-ylethyl]amino]ethyl] 5-bromo-2-hydroxybenzoate (PubChem CID 8022071) has the molecular formula C15H14BrNO4S and a molecular weight of 384.25 g/mol. Its IUPAC name is [2-oxo-2-[[(1R)-1-thiophen-2-ylethyl]amino]ethyl] 5-bromo-2-hydroxybenzoate.
| Compound Name | [2-oxo-2-[[(1R)-1-thiophen-2-ylethyl]amino]ethyl] 5-bromo-2-hydroxybenzoate |
|---|---|
| PubChem CID | 8022071 |
| Molecular Formula | C15H14BrNO4S |
| Molecular Weight | 384.25 g/mol |
| Exact Mass | 382.98 |
| IUPAC Name | [2-oxo-2-[[(1R)-1-thiophen-2-ylethyl]amino]ethyl] 5-bromo-2-hydroxybenzoate |
| SMILES | C[C@@H](NC(=O)COC(=O)c1cc(Br)ccc1O)c1cccs1 |
| InChI | InChI=1S/C15H14BrNO4S/c1-9(13-3-2-6-22-13)17-14(19)8-21-15(20)11-7-10(16)4-5-12(11)18/h2-7,9,18H,8H2,1H3,(H,17,19)/t9-/m1/s1 |
| InChIKey | OQFZPYVULNXCAM-SECBINFHSA-N |
| XLogP | 3.25 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.25 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |