C13H16BrNO4 — CID 2630341
[2-(tert-butylamino)-2-oxoethyl] 5-bromo-2-hydroxybenzoate (PubChem CID 2630341) has the molecular formula C13H16BrNO4 and a molecular weight of 330.18 g/mol. Its IUPAC name is [2-(tert-butylamino)-2-oxoethyl] 5-bromo-2-hydroxybenzoate.
| Compound Name | [2-(tert-butylamino)-2-oxoethyl] 5-bromo-2-hydroxybenzoate |
|---|---|
| PubChem CID | 2630341 |
| Molecular Formula | C13H16BrNO4 |
| Molecular Weight | 330.18 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | [2-(tert-butylamino)-2-oxoethyl] 5-bromo-2-hydroxybenzoate |
| SMILES | CC(C)(C)NC(=O)COC(=O)c1cc(Br)ccc1O |
| InChI | InChI=1S/C13H16BrNO4/c1-13(2,3)15-11(17)7-19-12(18)9-6-8(14)4-5-10(9)16/h4-6,16H,7H2,1-3H3,(H,15,17) |
| InChIKey | ZUBWOJBNBQBHMU-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.18 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |