C15H9BrF3NO4 — CID 16525414
[2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 5-bromo-2-hydroxybenzoate (PubChem CID 16525414) has the molecular formula C15H9BrF3NO4 and a molecular weight of 404.14 g/mol. Its IUPAC name is [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 5-bromo-2-hydroxybenzoate.
| Compound Name | [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 5-bromo-2-hydroxybenzoate |
|---|---|
| PubChem CID | 16525414 |
| Molecular Formula | C15H9BrF3NO4 |
| Molecular Weight | 404.14 g/mol |
| Exact Mass | 402.97 |
| IUPAC Name | [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 5-bromo-2-hydroxybenzoate |
| SMILES | O=C(COC(=O)c1cc(Br)ccc1O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C15H9BrF3NO4/c16-7-1-4-11(21)8(5-7)15(23)24-6-12(22)20-10-3-2-9(17)13(18)14(10)19/h1-5,21H,6H2,(H,20,22) |
| InChIKey | CQEXHASHAZFKRK-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.14 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|