C15H9BrF3NO3 — CID 9387880
[2-(2,5-difluoroanilino)-2-oxoethyl] 4-bromo-2-fluorobenzoate (PubChem CID 9387880) has the molecular formula C15H9BrF3NO3 and a molecular weight of 388.14 g/mol. Its IUPAC name is [2-(2,5-difluoroanilino)-2-oxoethyl] 4-bromo-2-fluorobenzoate.
| Compound Name | [2-(2,5-difluoroanilino)-2-oxoethyl] 4-bromo-2-fluorobenzoate |
|---|---|
| PubChem CID | 9387880 |
| Molecular Formula | C15H9BrF3NO3 |
| Molecular Weight | 388.14 g/mol |
| Exact Mass | 386.97 |
| IUPAC Name | [2-(2,5-difluoroanilino)-2-oxoethyl] 4-bromo-2-fluorobenzoate |
| SMILES | O=C(COC(=O)c1ccc(Br)cc1F)Nc1cc(F)ccc1F |
| InChI | InChI=1S/C15H9BrF3NO3/c16-8-1-3-10(12(19)5-8)15(22)23-7-14(21)20-13-6-9(17)2-4-11(13)18/h1-6H,7H2,(H,20,21) |
| InChIKey | USIFGPIMMRQKMF-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.14 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |