C17H15BrFNO4 — CID 9387802
[2-(2-ethoxyanilino)-2-oxoethyl] 4-bromo-2-fluorobenzoate (PubChem CID 9387802) has the molecular formula C17H15BrFNO4 and a molecular weight of 396.21 g/mol. Its IUPAC name is [2-(2-ethoxyanilino)-2-oxoethyl] 4-bromo-2-fluorobenzoate.
| Compound Name | [2-(2-ethoxyanilino)-2-oxoethyl] 4-bromo-2-fluorobenzoate |
|---|---|
| PubChem CID | 9387802 |
| Molecular Formula | C17H15BrFNO4 |
| Molecular Weight | 396.21 g/mol |
| Exact Mass | 395.02 |
| IUPAC Name | [2-(2-ethoxyanilino)-2-oxoethyl] 4-bromo-2-fluorobenzoate |
| SMILES | CCOc1ccccc1NC(=O)COC(=O)c1ccc(Br)cc1F |
| InChI | InChI=1S/C17H15BrFNO4/c1-2-23-15-6-4-3-5-14(15)20-16(21)10-24-17(22)12-8-7-11(18)9-13(12)19/h3-9H,2,10H2,1H3,(H,20,21) |
| InChIKey | URLYETMAPQUUMR-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.21 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |