C17H17ClN2O4 — CID 7472435
[2-(2-ethoxyanilino)-2-oxoethyl] 2-amino-5-chlorobenzoate (PubChem CID 7472435) has the molecular formula C17H17ClN2O4 and a molecular weight of 348.79 g/mol. Its IUPAC name is [2-(2-ethoxyanilino)-2-oxoethyl] 2-amino-5-chlorobenzoate.
| Compound Name | [2-(2-ethoxyanilino)-2-oxoethyl] 2-amino-5-chlorobenzoate |
|---|---|
| PubChem CID | 7472435 |
| Molecular Formula | C17H17ClN2O4 |
| Molecular Weight | 348.79 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | [2-(2-ethoxyanilino)-2-oxoethyl] 2-amino-5-chlorobenzoate |
| SMILES | CCOc1ccccc1NC(=O)COC(=O)c1cc(Cl)ccc1N |
| InChI | InChI=1S/C17H17ClN2O4/c1-2-23-15-6-4-3-5-14(15)20-16(21)10-24-17(22)12-9-11(18)7-8-13(12)19/h3-9H,2,10,19H2,1H3,(H,20,21) |
| InChIKey | BORLXSRDVQJYHS-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.79 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|