C19H21ClN2O6S — CID 2523972
[2-(2-ethoxyanilino)-2-oxoethyl] 2-chloro-5-(dimethylsulfamoyl)benzoate (PubChem CID 2523972) has the molecular formula C19H21ClN2O6S and a molecular weight of 440.91 g/mol. Its IUPAC name is [2-(2-ethoxyanilino)-2-oxoethyl] 2-chloro-5-(dimethylsulfamoyl)benzoate.
| Compound Name | [2-(2-ethoxyanilino)-2-oxoethyl] 2-chloro-5-(dimethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 2523972 |
| Molecular Formula | C19H21ClN2O6S |
| Molecular Weight | 440.91 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | [2-(2-ethoxyanilino)-2-oxoethyl] 2-chloro-5-(dimethylsulfamoyl)benzoate |
| SMILES | CCOc1ccccc1NC(=O)COC(=O)c1cc(S(=O)(=O)N(C)C)ccc1Cl |
| InChI | InChI=1S/C19H21ClN2O6S/c1-4-27-17-8-6-5-7-16(17)21-18(23)12-28-19(24)14-11-13(9-10-15(14)20)29(25,26)22(2)3/h5-11H,4,12H2,1-3H3,(H,21,23) |
| InChIKey | NBBOZZJZNQIIRK-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.91 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |