C18H18ClNO6S — CID 2662062
[2-(2-chloro-5-methylsulfonylanilino)-2-oxoethyl] 2-ethoxybenzoate (PubChem CID 2662062) has the molecular formula C18H18ClNO6S and a molecular weight of 411.86 g/mol. Its IUPAC name is [2-(2-chloro-5-methylsulfonylanilino)-2-oxoethyl] 2-ethoxybenzoate.
| Compound Name | [2-(2-chloro-5-methylsulfonylanilino)-2-oxoethyl] 2-ethoxybenzoate |
|---|---|
| PubChem CID | 2662062 |
| Molecular Formula | C18H18ClNO6S |
| Molecular Weight | 411.86 g/mol |
| Exact Mass | 411.05 |
| IUPAC Name | [2-(2-chloro-5-methylsulfonylanilino)-2-oxoethyl] 2-ethoxybenzoate |
| SMILES | CCOc1ccccc1C(=O)OCC(=O)Nc1cc(S(C)(=O)=O)ccc1Cl |
| InChI | InChI=1S/C18H18ClNO6S/c1-3-25-16-7-5-4-6-13(16)18(22)26-11-17(21)20-15-10-12(27(2,23)24)8-9-14(15)19/h4-10H,3,11H2,1-2H3,(H,20,21) |
| InChIKey | CPZOLAMVKDCZOO-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.86 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |