C18H18ClNO7S — CID 2662050
[2-(2-chloro-5-methylsulfonylanilino)-2-oxoethyl] 2,3-dimethoxybenzoate (PubChem CID 2662050) has the molecular formula C18H18ClNO7S and a molecular weight of 427.86 g/mol. Its IUPAC name is [2-(2-chloro-5-methylsulfonylanilino)-2-oxoethyl] 2,3-dimethoxybenzoate.
| Compound Name | [2-(2-chloro-5-methylsulfonylanilino)-2-oxoethyl] 2,3-dimethoxybenzoate |
|---|---|
| PubChem CID | 2662050 |
| Molecular Formula | C18H18ClNO7S |
| Molecular Weight | 427.86 g/mol |
| Exact Mass | 427.05 |
| IUPAC Name | [2-(2-chloro-5-methylsulfonylanilino)-2-oxoethyl] 2,3-dimethoxybenzoate |
| SMILES | COc1cccc(C(=O)OCC(=O)Nc2cc(S(C)(=O)=O)ccc2Cl)c1OC |
| InChI | InChI=1S/C18H18ClNO7S/c1-25-15-6-4-5-12(17(15)26-2)18(22)27-10-16(21)20-14-9-11(28(3,23)24)7-8-13(14)19/h4-9H,10H2,1-3H3,(H,20,21) |
| InChIKey | GJAMGQQQRFESNV-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.86 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |