C14H12ClNO5S2 — CID 2662070
[2-(2-chloro-5-methylsulfonylanilino)-2-oxoethyl] thiophene-2-carboxylate (PubChem CID 2662070) has the molecular formula C14H12ClNO5S2 and a molecular weight of 373.84 g/mol. Its IUPAC name is [2-(2-chloro-5-methylsulfonylanilino)-2-oxoethyl] thiophene-2-carboxylate.
| Compound Name | [2-(2-chloro-5-methylsulfonylanilino)-2-oxoethyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 2662070 |
| Molecular Formula | C14H12ClNO5S2 |
| Molecular Weight | 373.84 g/mol |
| Exact Mass | 372.98 |
| IUPAC Name | [2-(2-chloro-5-methylsulfonylanilino)-2-oxoethyl] thiophene-2-carboxylate |
| SMILES | CS(=O)(=O)c1ccc(Cl)c(NC(=O)COC(=O)c2cccs2)c1 |
| InChI | InChI=1S/C14H12ClNO5S2/c1-23(19,20)9-4-5-10(15)11(7-9)16-13(17)8-21-14(18)12-3-2-6-22-12/h2-7H,8H2,1H3,(H,16,17) |
| InChIKey | DHWJKGRHRUUUGL-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.84 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |