C16H13ClINO5S — CID 2662027
[2-(2-chloro-5-methylsulfonylanilino)-2-oxoethyl] 2-iodobenzoate (PubChem CID 2662027) has the molecular formula C16H13ClINO5S and a molecular weight of 493.71 g/mol. Its IUPAC name is [2-(2-chloro-5-methylsulfonylanilino)-2-oxoethyl] 2-iodobenzoate.
| Compound Name | [2-(2-chloro-5-methylsulfonylanilino)-2-oxoethyl] 2-iodobenzoate |
|---|---|
| PubChem CID | 2662027 |
| Molecular Formula | C16H13ClINO5S |
| Molecular Weight | 493.71 g/mol |
| Exact Mass | 492.92 |
| IUPAC Name | [2-(2-chloro-5-methylsulfonylanilino)-2-oxoethyl] 2-iodobenzoate |
| SMILES | CS(=O)(=O)c1ccc(Cl)c(NC(=O)COC(=O)c2ccccc2I)c1 |
| InChI | InChI=1S/C16H13ClINO5S/c1-25(22,23)10-6-7-12(17)14(8-10)19-15(20)9-24-16(21)11-4-2-3-5-13(11)18/h2-8H,9H2,1H3,(H,19,20) |
| InChIKey | MWPSHEMLJKFWLY-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.71 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|