C16H12Cl3NO5S — CID 2503052
[2-(2,5-dichloroanilino)-2-oxoethyl] 2-chloro-5-methylsulfonylbenzoate (PubChem CID 2503052) has the molecular formula C16H12Cl3NO5S and a molecular weight of 436.70 g/mol. Its IUPAC name is [2-(2,5-dichloroanilino)-2-oxoethyl] 2-chloro-5-methylsulfonylbenzoate.
| Compound Name | [2-(2,5-dichloroanilino)-2-oxoethyl] 2-chloro-5-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 2503052 |
| Molecular Formula | C16H12Cl3NO5S |
| Molecular Weight | 436.70 g/mol |
| Exact Mass | 434.95 |
| IUPAC Name | [2-(2,5-dichloroanilino)-2-oxoethyl] 2-chloro-5-methylsulfonylbenzoate |
| SMILES | CS(=O)(=O)c1ccc(Cl)c(C(=O)OCC(=O)Nc2cc(Cl)ccc2Cl)c1 |
| InChI | InChI=1S/C16H12Cl3NO5S/c1-26(23,24)10-3-5-12(18)11(7-10)16(22)25-8-15(21)20-14-6-9(17)2-4-13(14)19/h2-7H,8H2,1H3,(H,20,21) |
| InChIKey | FIVOSYNNYICWAB-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.70 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |