C16H13Cl2NO5S — CID 41174699
[2-(4-methylsulfonylanilino)-2-oxoethyl] 2,4-dichlorobenzoate (PubChem CID 41174699) has the molecular formula C16H13Cl2NO5S and a molecular weight of 402.26 g/mol. Its IUPAC name is [2-(4-methylsulfonylanilino)-2-oxoethyl] 2,4-dichlorobenzoate.
| Compound Name | [2-(4-methylsulfonylanilino)-2-oxoethyl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 41174699 |
| Molecular Formula | C16H13Cl2NO5S |
| Molecular Weight | 402.26 g/mol |
| Exact Mass | 400.99 |
| IUPAC Name | [2-(4-methylsulfonylanilino)-2-oxoethyl] 2,4-dichlorobenzoate |
| SMILES | CS(=O)(=O)c1ccc(NC(=O)COC(=O)c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C16H13Cl2NO5S/c1-25(22,23)12-5-3-11(4-6-12)19-15(20)9-24-16(21)13-7-2-10(17)8-14(13)18/h2-8H,9H2,1H3,(H,19,20) |
| InChIKey | IRDDZXIPXJXUEX-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.26 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |