C17H16ClN3O4 — CID 7864627
[2-(4-acetamidoanilino)-2-oxoethyl] 2-amino-4-chlorobenzoate (PubChem CID 7864627) has the molecular formula C17H16ClN3O4 and a molecular weight of 361.79 g/mol. Its IUPAC name is [2-(4-acetamidoanilino)-2-oxoethyl] 2-amino-4-chlorobenzoate.
| Compound Name | [2-(4-acetamidoanilino)-2-oxoethyl] 2-amino-4-chlorobenzoate |
|---|---|
| PubChem CID | 7864627 |
| Molecular Formula | C17H16ClN3O4 |
| Molecular Weight | 361.79 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | [2-(4-acetamidoanilino)-2-oxoethyl] 2-amino-4-chlorobenzoate |
| SMILES | CC(=O)Nc1ccc(NC(=O)COC(=O)c2ccc(Cl)cc2N)cc1 |
| InChI | InChI=1S/C17H16ClN3O4/c1-10(22)20-12-3-5-13(6-4-12)21-16(23)9-25-17(24)14-7-2-11(18)8-15(14)19/h2-8H,9,19H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | QSZBTRQRHNTOAT-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.79 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|