C16H13ClN4O4 — CID 24661458
[2-oxo-2-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]ethyl] 2-amino-4-chlorobenzoate (PubChem CID 24661458) has the molecular formula C16H13ClN4O4 and a molecular weight of 360.76 g/mol. Its IUPAC name is [2-oxo-2-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]ethyl] 2-amino-4-chlorobenzoate.
| Compound Name | [2-oxo-2-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]ethyl] 2-amino-4-chlorobenzoate |
|---|---|
| PubChem CID | 24661458 |
| Molecular Formula | C16H13ClN4O4 |
| Molecular Weight | 360.76 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | [2-oxo-2-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]ethyl] 2-amino-4-chlorobenzoate |
| SMILES | Nc1cc(Cl)ccc1C(=O)OCC(=O)Nc1ccc2[nH]c(=O)[nH]c2c1 |
| InChI | InChI=1S/C16H13ClN4O4/c17-8-1-3-10(11(18)5-8)15(23)25-7-14(22)19-9-2-4-12-13(6-9)21-16(24)20-12/h1-6H,7,18H2,(H,19,22)(H2,20,21,24) |
| InChIKey | KQVPWJBJKARGJP-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 130.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.76 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|