C16H12ClN3O3 — CID 7864602
[2-(4-cyanoanilino)-2-oxoethyl] 2-amino-4-chlorobenzoate (PubChem CID 7864602) has the molecular formula C16H12ClN3O3 and a molecular weight of 329.74 g/mol. Its IUPAC name is [2-(4-cyanoanilino)-2-oxoethyl] 2-amino-4-chlorobenzoate.
| Compound Name | [2-(4-cyanoanilino)-2-oxoethyl] 2-amino-4-chlorobenzoate |
|---|---|
| PubChem CID | 7864602 |
| Molecular Formula | C16H12ClN3O3 |
| Molecular Weight | 329.74 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | [2-(4-cyanoanilino)-2-oxoethyl] 2-amino-4-chlorobenzoate |
| SMILES | N#Cc1ccc(NC(=O)COC(=O)c2ccc(Cl)cc2N)cc1 |
| InChI | InChI=1S/C16H12ClN3O3/c17-11-3-6-13(14(19)7-11)16(22)23-9-15(21)20-12-4-1-10(8-18)2-5-12/h1-7H,9,19H2,(H,20,21) |
| InChIKey | QXBQEXURCPKOOW-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 105.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.74 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|