About [2-(4-fluoroanilino)-2-oxoethyl] 4-cyano-2-fluorobenzoate
[2-(4-fluoroanilino)-2-oxoethyl] 4-cyano-2-fluorobenzoate (PubChem CID 126208095) has the molecular formula C16H10F2N2O3
and a molecular weight of 316.26 g/mol. Its IUPAC name is [2-(4-fluoroanilino)-2-oxoethyl] 4-cyano-2-fluorobenzoate.
Molecular Properties
| Compound Name | [2-(4-fluoroanilino)-2-oxoethyl] 4-cyano-2-fluorobenzoate |
| PubChem CID | 126208095 |
| Molecular Formula | C16H10F2N2O3 |
| Molecular Weight | 316.26 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | [2-(4-fluoroanilino)-2-oxoethyl] 4-cyano-2-fluorobenzoate |
| SMILES | N#Cc1ccc(C(=O)OCC(=O)Nc2ccc(F)cc2)c(F)c1 |
| InChI | InChI=1S/C16H10F2N2O3/c17-11-2-4-12(5-3-11)20-15(21)9-23-16(22)13-6-1-10(8-19)7-14(13)18/h1-7H,9H2,(H,20,21) |
| InChIKey | OVADXBDWDHJDDM-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.26 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(4-fluoroanilino)-2-oxoethyl] 4-cyano-2-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-fluoroanilino)-2-oxoethyl] 4-cyano-2-fluorobenzoate?
The IUPAC name of [2-(4-fluoroanilino)-2-oxoethyl] 4-cyano-2-fluorobenzoate (CID 126208095) is [2-(4-fluoroanilino)-2-oxoethyl] 4-cyano-2-fluorobenzoate.
What is the SMILES notation for [2-(4-fluoroanilino)-2-oxoethyl] 4-cyano-2-fluorobenzoate?
The canonical SMILES for [2-(4-fluoroanilino)-2-oxoethyl] 4-cyano-2-fluorobenzoate is N#Cc1ccc(C(=O)OCC(=O)Nc2ccc(F)cc2)c(F)c1.
What is the InChIKey of [2-(4-fluoroanilino)-2-oxoethyl] 4-cyano-2-fluorobenzoate?
The InChIKey is OVADXBDWDHJDDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10F2N2O3/c17-11-2-4-12(5-3-11)20-15(21)9-23-16(22)13-6-1-10(8-19)7-14(13)18/h1-7H,9H2,(H,20,21).
What are the key properties of [2-(4-fluoroanilino)-2-oxoethyl] 4-cyano-2-fluorobenzoate?
[2-(4-fluoroanilino)-2-oxoethyl] 4-cyano-2-fluorobenzoate has a molecular weight of 316.26 g/mol, XLogP of 2.63, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-fluoroanilino)-2-oxoethyl] 4-cyano-2-fluorobenzoate is sourced from PubChem (CID 126208095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).