C18H15FN2O3 — CID 126215267
[2-(3,4-dimethylanilino)-2-oxoethyl] 4-cyano-2-fluorobenzoate (PubChem CID 126215267) has the molecular formula C18H15FN2O3 and a molecular weight of 326.33 g/mol. Its IUPAC name is [2-(3,4-dimethylanilino)-2-oxoethyl] 4-cyano-2-fluorobenzoate.
| Compound Name | [2-(3,4-dimethylanilino)-2-oxoethyl] 4-cyano-2-fluorobenzoate |
|---|---|
| PubChem CID | 126215267 |
| Molecular Formula | C18H15FN2O3 |
| Molecular Weight | 326.33 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | [2-(3,4-dimethylanilino)-2-oxoethyl] 4-cyano-2-fluorobenzoate |
| SMILES | Cc1ccc(NC(=O)COC(=O)c2ccc(C#N)cc2F)cc1C |
| InChI | InChI=1S/C18H15FN2O3/c1-11-3-5-14(7-12(11)2)21-17(22)10-24-18(23)15-6-4-13(9-20)8-16(15)19/h3-8H,10H2,1-2H3,(H,21,22) |
| InChIKey | FFWYUBMMAUPFDI-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.33 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |