C17H12F2N2O3 — CID 7604295
[2-[4-(cyanomethyl)anilino]-2-oxoethyl] 2,4-difluorobenzoate (PubChem CID 7604295) has the molecular formula C17H12F2N2O3 and a molecular weight of 330.29 g/mol. Its IUPAC name is [2-[4-(cyanomethyl)anilino]-2-oxoethyl] 2,4-difluorobenzoate.
| Compound Name | [2-[4-(cyanomethyl)anilino]-2-oxoethyl] 2,4-difluorobenzoate |
|---|---|
| PubChem CID | 7604295 |
| Molecular Formula | C17H12F2N2O3 |
| Molecular Weight | 330.29 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | [2-[4-(cyanomethyl)anilino]-2-oxoethyl] 2,4-difluorobenzoate |
| SMILES | N#CCc1ccc(NC(=O)COC(=O)c2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C17H12F2N2O3/c18-12-3-6-14(15(19)9-12)17(23)24-10-16(22)21-13-4-1-11(2-5-13)7-8-20/h1-6,9H,7,10H2,(H,21,22) |
| InChIKey | IYHZQKXMMDRAQD-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.29 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |