C18H14FN3O4 — CID 7878238
[2-(4-cyanoanilino)-2-oxoethyl] 2-[(4-fluorobenzoyl)amino]acetate (PubChem CID 7878238) has the molecular formula C18H14FN3O4 and a molecular weight of 355.33 g/mol. Its IUPAC name is [2-(4-cyanoanilino)-2-oxoethyl] 2-[(4-fluorobenzoyl)amino]acetate.
| Compound Name | [2-(4-cyanoanilino)-2-oxoethyl] 2-[(4-fluorobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 7878238 |
| Molecular Formula | C18H14FN3O4 |
| Molecular Weight | 355.33 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | [2-(4-cyanoanilino)-2-oxoethyl] 2-[(4-fluorobenzoyl)amino]acetate |
| SMILES | N#Cc1ccc(NC(=O)COC(=O)CNC(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C18H14FN3O4/c19-14-5-3-13(4-6-14)18(25)21-10-17(24)26-11-16(23)22-15-7-1-12(9-20)2-8-15/h1-8H,10-11H2,(H,21,25)(H,22,23) |
| InChIKey | DGEMQODERSITTG-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.33 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |