C24H19N3O4 — CID 8921393
[2-(3-cyanoanilino)-2-oxoethyl] 2-[(4-phenylbenzoyl)amino]acetate (PubChem CID 8921393) has the molecular formula C24H19N3O4 and a molecular weight of 413.43 g/mol. Its IUPAC name is [2-(3-cyanoanilino)-2-oxoethyl] 2-[(4-phenylbenzoyl)amino]acetate.
| Compound Name | [2-(3-cyanoanilino)-2-oxoethyl] 2-[(4-phenylbenzoyl)amino]acetate |
|---|---|
| PubChem CID | 8921393 |
| Molecular Formula | C24H19N3O4 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | [2-(3-cyanoanilino)-2-oxoethyl] 2-[(4-phenylbenzoyl)amino]acetate |
| SMILES | N#Cc1cccc(NC(=O)COC(=O)CNC(=O)c2ccc(-c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C24H19N3O4/c25-14-17-5-4-8-21(13-17)27-22(28)16-31-23(29)15-26-24(30)20-11-9-19(10-12-20)18-6-2-1-3-7-18/h1-13H,15-16H2,(H,26,30)(H,27,28) |
| InChIKey | QCMZSPHESKNHJL-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |