C12H12N2O3 — CID 7851425
[2-(4-cyanoanilino)-2-oxoethyl] propanoate (PubChem CID 7851425) has the molecular formula C12H12N2O3 and a molecular weight of 232.24 g/mol. Its IUPAC name is [2-(4-cyanoanilino)-2-oxoethyl] propanoate.
| Compound Name | [2-(4-cyanoanilino)-2-oxoethyl] propanoate |
|---|---|
| PubChem CID | 7851425 |
| Molecular Formula | C12H12N2O3 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | [2-(4-cyanoanilino)-2-oxoethyl] propanoate |
| SMILES | CCC(=O)OCC(=O)Nc1ccc(C#N)cc1 |
| InChI | InChI=1S/C12H12N2O3/c1-2-12(16)17-8-11(15)14-10-5-3-9(7-13)4-6-10/h3-6H,2,8H2,1H3,(H,14,15) |
| InChIKey | HRMBAYANOJMJBM-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |