About [2-(4-cyanoanilino)-2-oxoethyl] 3-phenoxypropanoate
[2-(4-cyanoanilino)-2-oxoethyl] 3-phenoxypropanoate (PubChem CID 2399979) has the molecular formula C18H16N2O4
and a molecular weight of 324.34 g/mol. Its IUPAC name is [2-(4-cyanoanilino)-2-oxoethyl] 3-phenoxypropanoate.
Molecular Properties
| Compound Name | [2-(4-cyanoanilino)-2-oxoethyl] 3-phenoxypropanoate |
| PubChem CID | 2399979 |
| Molecular Formula | C18H16N2O4 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | [2-(4-cyanoanilino)-2-oxoethyl] 3-phenoxypropanoate |
| SMILES | N#Cc1ccc(NC(=O)COC(=O)CCOc2ccccc2)cc1 |
| InChI | InChI=1S/C18H16N2O4/c19-12-14-6-8-15(9-7-14)20-17(21)13-24-18(22)10-11-23-16-4-2-1-3-5-16/h1-9H,10-11,13H2,(H,20,21) |
| InChIKey | MGFCZPHRVZRTQD-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-(4-cyanoanilino)-2-oxoethyl] 3-phenoxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-cyanoanilino)-2-oxoethyl] 3-phenoxypropanoate?
The IUPAC name of [2-(4-cyanoanilino)-2-oxoethyl] 3-phenoxypropanoate (CID 2399979) is [2-(4-cyanoanilino)-2-oxoethyl] 3-phenoxypropanoate.
What is the SMILES notation for [2-(4-cyanoanilino)-2-oxoethyl] 3-phenoxypropanoate?
The canonical SMILES for [2-(4-cyanoanilino)-2-oxoethyl] 3-phenoxypropanoate is N#Cc1ccc(NC(=O)COC(=O)CCOc2ccccc2)cc1.
What is the InChIKey of [2-(4-cyanoanilino)-2-oxoethyl] 3-phenoxypropanoate?
The InChIKey is MGFCZPHRVZRTQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N2O4/c19-12-14-6-8-15(9-7-14)20-17(21)13-24-18(22)10-11-23-16-4-2-1-3-5-16/h1-9H,10-11,13H2,(H,20,21).
What are the key properties of [2-(4-cyanoanilino)-2-oxoethyl] 3-phenoxypropanoate?
[2-(4-cyanoanilino)-2-oxoethyl] 3-phenoxypropanoate has a molecular weight of 324.34 g/mol, XLogP of 2.51, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-cyanoanilino)-2-oxoethyl] 3-phenoxypropanoate is sourced from PubChem (CID 2399979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).