C23H18N2O3 — CID 4803020
[2-(4-cyanoanilino)-2-oxoethyl] 2-(4-phenylphenyl)acetate (PubChem CID 4803020) has the molecular formula C23H18N2O3 and a molecular weight of 370.41 g/mol. Its IUPAC name is [2-(4-cyanoanilino)-2-oxoethyl] 2-(4-phenylphenyl)acetate.
| Compound Name | [2-(4-cyanoanilino)-2-oxoethyl] 2-(4-phenylphenyl)acetate |
|---|---|
| PubChem CID | 4803020 |
| Molecular Formula | C23H18N2O3 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | [2-(4-cyanoanilino)-2-oxoethyl] 2-(4-phenylphenyl)acetate |
| SMILES | N#Cc1ccc(NC(=O)COC(=O)Cc2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C23H18N2O3/c24-15-18-8-12-21(13-9-18)25-22(26)16-28-23(27)14-17-6-10-20(11-7-17)19-4-2-1-3-5-19/h1-13H,14,16H2,(H,25,26) |
| InChIKey | PXDOMTJDEZUVQP-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |