About [2-(4-cyanoanilino)-2-oxoethyl] 2-naphthalen-2-ylacetate
[2-(4-cyanoanilino)-2-oxoethyl] 2-naphthalen-2-ylacetate (PubChem CID 7828754) has the molecular formula C21H16N2O3
and a molecular weight of 344.37 g/mol. Its IUPAC name is [2-(4-cyanoanilino)-2-oxoethyl] 2-naphthalen-2-ylacetate.
Molecular Properties
| Compound Name | [2-(4-cyanoanilino)-2-oxoethyl] 2-naphthalen-2-ylacetate |
| PubChem CID | 7828754 |
| Molecular Formula | C21H16N2O3 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | [2-(4-cyanoanilino)-2-oxoethyl] 2-naphthalen-2-ylacetate |
| SMILES | N#Cc1ccc(NC(=O)COC(=O)Cc2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C21H16N2O3/c22-13-15-6-9-19(10-7-15)23-20(24)14-26-21(25)12-16-5-8-17-3-1-2-4-18(17)11-16/h1-11H,12,14H2,(H,23,24) |
| InChIKey | YEOAQKYEJFNSPL-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(4-cyanoanilino)-2-oxoethyl] 2-naphthalen-2-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-cyanoanilino)-2-oxoethyl] 2-naphthalen-2-ylacetate?
The IUPAC name of [2-(4-cyanoanilino)-2-oxoethyl] 2-naphthalen-2-ylacetate (CID 7828754) is [2-(4-cyanoanilino)-2-oxoethyl] 2-naphthalen-2-ylacetate.
What is the SMILES notation for [2-(4-cyanoanilino)-2-oxoethyl] 2-naphthalen-2-ylacetate?
The canonical SMILES for [2-(4-cyanoanilino)-2-oxoethyl] 2-naphthalen-2-ylacetate is N#Cc1ccc(NC(=O)COC(=O)Cc2ccc3ccccc3c2)cc1.
What is the InChIKey of [2-(4-cyanoanilino)-2-oxoethyl] 2-naphthalen-2-ylacetate?
The InChIKey is YEOAQKYEJFNSPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16N2O3/c22-13-15-6-9-19(10-7-15)23-20(24)14-26-21(25)12-16-5-8-17-3-1-2-4-18(17)11-16/h1-11H,12,14H2,(H,23,24).
What are the key properties of [2-(4-cyanoanilino)-2-oxoethyl] 2-naphthalen-2-ylacetate?
[2-(4-cyanoanilino)-2-oxoethyl] 2-naphthalen-2-ylacetate has a molecular weight of 344.37 g/mol, XLogP of 3.44, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-cyanoanilino)-2-oxoethyl] 2-naphthalen-2-ylacetate is sourced from PubChem (CID 7828754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).