C22H21NO3 — CID 7828719
[2-(3,5-dimethylanilino)-2-oxoethyl] 2-naphthalen-2-ylacetate (PubChem CID 7828719) has the molecular formula C22H21NO3 and a molecular weight of 347.41 g/mol. Its IUPAC name is [2-(3,5-dimethylanilino)-2-oxoethyl] 2-naphthalen-2-ylacetate.
| Compound Name | [2-(3,5-dimethylanilino)-2-oxoethyl] 2-naphthalen-2-ylacetate |
|---|---|
| PubChem CID | 7828719 |
| Molecular Formula | C22H21NO3 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | [2-(3,5-dimethylanilino)-2-oxoethyl] 2-naphthalen-2-ylacetate |
| SMILES | Cc1cc(C)cc(NC(=O)COC(=O)Cc2ccc3ccccc3c2)c1 |
| InChI | InChI=1S/C22H21NO3/c1-15-9-16(2)11-20(10-15)23-21(24)14-26-22(25)13-17-7-8-18-5-3-4-6-19(18)12-17/h3-12H,13-14H2,1-2H3,(H,23,24) |
| InChIKey | PFPPOLBVRVVKQB-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |