About [2-oxo-2-(2-phenylanilino)ethyl] 2-naphthalen-2-ylacetate
[2-oxo-2-(2-phenylanilino)ethyl] 2-naphthalen-2-ylacetate (PubChem CID 7828531) has the molecular formula C26H21NO3
and a molecular weight of 395.46 g/mol. Its IUPAC name is [2-oxo-2-(2-phenylanilino)ethyl] 2-naphthalen-2-ylacetate.
Molecular Properties
| Compound Name | [2-oxo-2-(2-phenylanilino)ethyl] 2-naphthalen-2-ylacetate |
| PubChem CID | 7828531 |
| Molecular Formula | C26H21NO3 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | [2-oxo-2-(2-phenylanilino)ethyl] 2-naphthalen-2-ylacetate |
| SMILES | O=C(COC(=O)Cc1ccc2ccccc2c1)Nc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C26H21NO3/c28-25(27-24-13-7-6-12-23(24)21-9-2-1-3-10-21)18-30-26(29)17-19-14-15-20-8-4-5-11-22(20)16-19/h1-16H,17-18H2,(H,27,28) |
| InChIKey | SUDJVFVQCQVTQR-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-oxo-2-(2-phenylanilino)ethyl] 2-naphthalen-2-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-(2-phenylanilino)ethyl] 2-naphthalen-2-ylacetate?
The IUPAC name of [2-oxo-2-(2-phenylanilino)ethyl] 2-naphthalen-2-ylacetate (CID 7828531) is [2-oxo-2-(2-phenylanilino)ethyl] 2-naphthalen-2-ylacetate.
What is the SMILES notation for [2-oxo-2-(2-phenylanilino)ethyl] 2-naphthalen-2-ylacetate?
The canonical SMILES for [2-oxo-2-(2-phenylanilino)ethyl] 2-naphthalen-2-ylacetate is O=C(COC(=O)Cc1ccc2ccccc2c1)Nc1ccccc1-c1ccccc1.
What is the InChIKey of [2-oxo-2-(2-phenylanilino)ethyl] 2-naphthalen-2-ylacetate?
The InChIKey is SUDJVFVQCQVTQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H21NO3/c28-25(27-24-13-7-6-12-23(24)21-9-2-1-3-10-21)18-30-26(29)17-19-14-15-20-8-4-5-11-22(20)16-19/h1-16H,17-18H2,(H,27,28).
What are the key properties of [2-oxo-2-(2-phenylanilino)ethyl] 2-naphthalen-2-ylacetate?
[2-oxo-2-(2-phenylanilino)ethyl] 2-naphthalen-2-ylacetate has a molecular weight of 395.46 g/mol, XLogP of 5.23, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-(2-phenylanilino)ethyl] 2-naphthalen-2-ylacetate is sourced from PubChem (CID 7828531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).