C15H14N2O4 — CID 7828580
[2-(carbamoylamino)-2-oxoethyl] 2-naphthalen-2-ylacetate (PubChem CID 7828580) has the molecular formula C15H14N2O4 and a molecular weight of 286.29 g/mol. Its IUPAC name is [2-(carbamoylamino)-2-oxoethyl] 2-naphthalen-2-ylacetate.
| Compound Name | [2-(carbamoylamino)-2-oxoethyl] 2-naphthalen-2-ylacetate |
|---|---|
| PubChem CID | 7828580 |
| Molecular Formula | C15H14N2O4 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | [2-(carbamoylamino)-2-oxoethyl] 2-naphthalen-2-ylacetate |
| SMILES | NC(=O)NC(=O)COC(=O)Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C15H14N2O4/c16-15(20)17-13(18)9-21-14(19)8-10-5-6-11-3-1-2-4-12(11)7-10/h1-7H,8-9H2,(H3,16,17,18,20) |
| InChIKey | VDZRJAUBUDQURL-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |