C21H18BrNO3 — CID 7828670
[2-(4-bromo-2-methylanilino)-2-oxoethyl] 2-naphthalen-2-ylacetate (PubChem CID 7828670) has the molecular formula C21H18BrNO3 and a molecular weight of 412.28 g/mol. Its IUPAC name is [2-(4-bromo-2-methylanilino)-2-oxoethyl] 2-naphthalen-2-ylacetate.
| Compound Name | [2-(4-bromo-2-methylanilino)-2-oxoethyl] 2-naphthalen-2-ylacetate |
|---|---|
| PubChem CID | 7828670 |
| Molecular Formula | C21H18BrNO3 |
| Molecular Weight | 412.28 g/mol |
| Exact Mass | 411.05 |
| IUPAC Name | [2-(4-bromo-2-methylanilino)-2-oxoethyl] 2-naphthalen-2-ylacetate |
| SMILES | Cc1cc(Br)ccc1NC(=O)COC(=O)Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H18BrNO3/c1-14-10-18(22)8-9-19(14)23-20(24)13-26-21(25)12-15-6-7-16-4-2-3-5-17(16)11-15/h2-11H,12-13H2,1H3,(H,23,24) |
| InChIKey | GIMJQMPWXMGCIF-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.28 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |