C21H18N2O5 — CID 7828504
[2-(2-methyl-5-nitroanilino)-2-oxoethyl] 2-naphthalen-2-ylacetate (PubChem CID 7828504) has the molecular formula C21H18N2O5 and a molecular weight of 378.38 g/mol. Its IUPAC name is [2-(2-methyl-5-nitroanilino)-2-oxoethyl] 2-naphthalen-2-ylacetate.
| Compound Name | [2-(2-methyl-5-nitroanilino)-2-oxoethyl] 2-naphthalen-2-ylacetate |
|---|---|
| PubChem CID | 7828504 |
| Molecular Formula | C21H18N2O5 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | [2-(2-methyl-5-nitroanilino)-2-oxoethyl] 2-naphthalen-2-ylacetate |
| SMILES | Cc1ccc([N+](=O)[O-])cc1NC(=O)COC(=O)Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H18N2O5/c1-14-6-9-18(23(26)27)12-19(14)22-20(24)13-28-21(25)11-15-7-8-16-4-2-3-5-17(16)10-15/h2-10,12H,11,13H2,1H3,(H,22,24) |
| InChIKey | MUUHNRSQRVEPSP-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|