C17H16N2O4 — CID 7828549
[2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl] 2-naphthalen-2-ylacetate (PubChem CID 7828549) has the molecular formula C17H16N2O4 and a molecular weight of 312.32 g/mol. Its IUPAC name is [2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl] 2-naphthalen-2-ylacetate.
| Compound Name | [2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl] 2-naphthalen-2-ylacetate |
|---|---|
| PubChem CID | 7828549 |
| Molecular Formula | C17H16N2O4 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | [2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl] 2-naphthalen-2-ylacetate |
| SMILES | O=C(Cc1ccc2ccccc2c1)OCC(=O)N1CCNC1=O |
| InChI | InChI=1S/C17H16N2O4/c20-15(19-8-7-18-17(19)22)11-23-16(21)10-12-5-6-13-3-1-2-4-14(13)9-12/h1-6,9H,7-8,10-11H2,(H,18,22) |
| InChIKey | YDZHNCXBAWTIEK-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |