C17H16N2O4S — CID 7795699
[2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl] 2-naphthalen-2-ylsulfanylacetate (PubChem CID 7795699) has the molecular formula C17H16N2O4S and a molecular weight of 344.39 g/mol. Its IUPAC name is [2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl] 2-naphthalen-2-ylsulfanylacetate.
| Compound Name | [2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl] 2-naphthalen-2-ylsulfanylacetate |
|---|---|
| PubChem CID | 7795699 |
| Molecular Formula | C17H16N2O4S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | [2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl] 2-naphthalen-2-ylsulfanylacetate |
| SMILES | O=C(CSc1ccc2ccccc2c1)OCC(=O)N1CCNC1=O |
| InChI | InChI=1S/C17H16N2O4S/c20-15(19-8-7-18-17(19)22)10-23-16(21)11-24-14-6-5-12-3-1-2-4-13(12)9-14/h1-6,9H,7-8,10-11H2,(H,18,22) |
| InChIKey | BDHHYNGLYXYPGO-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |