C14H15FN2O4S — CID 7972391
[2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl] 3-(4-fluorophenyl)sulfanylpropanoate (PubChem CID 7972391) has the molecular formula C14H15FN2O4S and a molecular weight of 326.35 g/mol. Its IUPAC name is [2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl] 3-(4-fluorophenyl)sulfanylpropanoate.
| Compound Name | [2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl] 3-(4-fluorophenyl)sulfanylpropanoate |
|---|---|
| PubChem CID | 7972391 |
| Molecular Formula | C14H15FN2O4S |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | [2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl] 3-(4-fluorophenyl)sulfanylpropanoate |
| SMILES | O=C(CCSc1ccc(F)cc1)OCC(=O)N1CCNC1=O |
| InChI | InChI=1S/C14H15FN2O4S/c15-10-1-3-11(4-2-10)22-8-5-13(19)21-9-12(18)17-7-6-16-14(17)20/h1-4H,5-9H2,(H,16,20) |
| InChIKey | QMIUZALRMWGZCO-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |