C14H13NO3S — CID 2096952
(2-amino-2-oxoethyl) 2-naphthalen-2-ylsulfanylacetate (PubChem CID 2096952) has the molecular formula C14H13NO3S and a molecular weight of 275.33 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) 2-naphthalen-2-ylsulfanylacetate.
| Compound Name | (2-amino-2-oxoethyl) 2-naphthalen-2-ylsulfanylacetate |
|---|---|
| PubChem CID | 2096952 |
| Molecular Formula | C14H13NO3S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | (2-amino-2-oxoethyl) 2-naphthalen-2-ylsulfanylacetate |
| SMILES | NC(=O)COC(=O)CSc1ccc2ccccc2c1 |
| InChI | InChI=1S/C14H13NO3S/c15-13(16)8-18-14(17)9-19-12-6-5-10-3-1-2-4-11(10)7-12/h1-7H,8-9H2,(H2,15,16) |
| InChIKey | BMKPETIUFJUTBB-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |