C22H27NO3S — CID 16525634
[2-(cyclooctylamino)-2-oxoethyl] 2-naphthalen-2-ylsulfanylacetate (PubChem CID 16525634) has the molecular formula C22H27NO3S and a molecular weight of 385.53 g/mol. Its IUPAC name is [2-(cyclooctylamino)-2-oxoethyl] 2-naphthalen-2-ylsulfanylacetate.
| Compound Name | [2-(cyclooctylamino)-2-oxoethyl] 2-naphthalen-2-ylsulfanylacetate |
|---|---|
| PubChem CID | 16525634 |
| Molecular Formula | C22H27NO3S |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | [2-(cyclooctylamino)-2-oxoethyl] 2-naphthalen-2-ylsulfanylacetate |
| SMILES | O=C(COC(=O)CSc1ccc2ccccc2c1)NC1CCCCCCC1 |
| InChI | InChI=1S/C22H27NO3S/c24-21(23-19-10-4-2-1-3-5-11-19)15-26-22(25)16-27-20-13-12-17-8-6-7-9-18(17)14-20/h6-9,12-14,19H,1-5,10-11,15-16H2,(H,23,24) |
| InChIKey | CVGUAUPSSZVVBC-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |