(2,6-dichlorophenyl)methyl 2-naphthalen-2-ylsulfanylacetate

C19H14Cl2O2S — CID 7795777

IUPAC(2,6-dichlorophenyl)methyl 2-naphthalen-2-ylsulfanylacetate
SMILESO=C(CSc1ccc2ccccc2c1)OCc1c(Cl)cccc1Cl
InChIInChI=1S/C19H14Cl2O2S/c20-17-6-3-7-18(21)16(17)11-23-19(22)12-24-15-9-8-13-4-1-2-5-14(13)10-15/h1-10H,11-12H2
InChIKeyOEGWRVJWXYOHQP-UHFFFAOYSA-N
MW377.29 g/mol
LogP5.98
Rot. Bonds5

About (2,6-dichlorophenyl)methyl 2-naphthalen-2-ylsulfanylacetate

(2,6-dichlorophenyl)methyl 2-naphthalen-2-ylsulfanylacetate (PubChem CID 7795777) has the molecular formula C19H14Cl2O2S and a molecular weight of 377.29 g/mol. Its IUPAC name is (2,6-dichlorophenyl)methyl 2-naphthalen-2-ylsulfanylacetate.

Molecular Properties

Compound Name(2,6-dichlorophenyl)methyl 2-naphthalen-2-ylsulfanylacetate
PubChem CID7795777
Molecular FormulaC19H14Cl2O2S
Molecular Weight377.29 g/mol
Exact Mass376.01
IUPAC Name(2,6-dichlorophenyl)methyl 2-naphthalen-2-ylsulfanylacetate
SMILESO=C(CSc1ccc2ccccc2c1)OCc1c(Cl)cccc1Cl
InChIInChI=1S/C19H14Cl2O2S/c20-17-6-3-7-18(21)16(17)11-23-19(22)12-24-15-9-8-13-4-1-2-5-14(13)10-15/h1-10H,11-12H2
InChIKeyOEGWRVJWXYOHQP-UHFFFAOYSA-N
XLogP5.98
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms24
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500377.29
LogP ≤ 55.98
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze (2,6-dichlorophenyl)methyl 2-naphthalen-2-ylsulfanylacetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,6-dichlorophenyl)methyl 2-naphthalen-2-ylsulfanylacetate?
The IUPAC name of (2,6-dichlorophenyl)methyl 2-naphthalen-2-ylsulfanylacetate (CID 7795777) is (2,6-dichlorophenyl)methyl 2-naphthalen-2-ylsulfanylacetate.
What is the SMILES notation for (2,6-dichlorophenyl)methyl 2-naphthalen-2-ylsulfanylacetate?
The canonical SMILES for (2,6-dichlorophenyl)methyl 2-naphthalen-2-ylsulfanylacetate is O=C(CSc1ccc2ccccc2c1)OCc1c(Cl)cccc1Cl.
What is the InChIKey of (2,6-dichlorophenyl)methyl 2-naphthalen-2-ylsulfanylacetate?
The InChIKey is OEGWRVJWXYOHQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14Cl2O2S/c20-17-6-3-7-18(21)16(17)11-23-19(22)12-24-15-9-8-13-4-1-2-5-14(13)10-15/h1-10H,11-12H2.
What are the key properties of (2,6-dichlorophenyl)methyl 2-naphthalen-2-ylsulfanylacetate?
(2,6-dichlorophenyl)methyl 2-naphthalen-2-ylsulfanylacetate has a molecular weight of 377.29 g/mol, XLogP of 5.98, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,6-dichlorophenyl)methyl 2-naphthalen-2-ylsulfanylacetate is sourced from PubChem (CID 7795777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).