C19H14Cl2O2S — CID 7795777
(2,6-dichlorophenyl)methyl 2-naphthalen-2-ylsulfanylacetate (PubChem CID 7795777) has the molecular formula C19H14Cl2O2S and a molecular weight of 377.29 g/mol. Its IUPAC name is (2,6-dichlorophenyl)methyl 2-naphthalen-2-ylsulfanylacetate.
| Compound Name | (2,6-dichlorophenyl)methyl 2-naphthalen-2-ylsulfanylacetate |
|---|---|
| PubChem CID | 7795777 |
| Molecular Formula | C19H14Cl2O2S |
| Molecular Weight | 377.29 g/mol |
| Exact Mass | 376.01 |
| IUPAC Name | (2,6-dichlorophenyl)methyl 2-naphthalen-2-ylsulfanylacetate |
| SMILES | O=C(CSc1ccc2ccccc2c1)OCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C19H14Cl2O2S/c20-17-6-3-7-18(21)16(17)11-23-19(22)12-24-15-9-8-13-4-1-2-5-14(13)10-15/h1-10H,11-12H2 |
| InChIKey | OEGWRVJWXYOHQP-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.29 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |