C22H20N2O5S — CID 2119188
[2-oxo-2-(4-sulfamoylanilino)ethyl] 2-(4-phenylphenyl)acetate (PubChem CID 2119188) has the molecular formula C22H20N2O5S and a molecular weight of 424.48 g/mol. Its IUPAC name is [2-oxo-2-(4-sulfamoylanilino)ethyl] 2-(4-phenylphenyl)acetate.
| Compound Name | [2-oxo-2-(4-sulfamoylanilino)ethyl] 2-(4-phenylphenyl)acetate |
|---|---|
| PubChem CID | 2119188 |
| Molecular Formula | C22H20N2O5S |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | [2-oxo-2-(4-sulfamoylanilino)ethyl] 2-(4-phenylphenyl)acetate |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)COC(=O)Cc2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C22H20N2O5S/c23-30(27,28)20-12-10-19(11-13-20)24-21(25)15-29-22(26)14-16-6-8-18(9-7-16)17-4-2-1-3-5-17/h1-13H,14-15H2,(H,24,25)(H2,23,27,28) |
| InChIKey | KUYWUIDCETVDMS-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |