C16H15FN2O5S — CID 8589912
[2-oxo-2-(4-sulfamoylanilino)ethyl] 2-(3-fluorophenyl)acetate (PubChem CID 8589912) has the molecular formula C16H15FN2O5S and a molecular weight of 366.37 g/mol. Its IUPAC name is [2-oxo-2-(4-sulfamoylanilino)ethyl] 2-(3-fluorophenyl)acetate.
| Compound Name | [2-oxo-2-(4-sulfamoylanilino)ethyl] 2-(3-fluorophenyl)acetate |
|---|---|
| PubChem CID | 8589912 |
| Molecular Formula | C16H15FN2O5S |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | [2-oxo-2-(4-sulfamoylanilino)ethyl] 2-(3-fluorophenyl)acetate |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)COC(=O)Cc2cccc(F)c2)cc1 |
| InChI | InChI=1S/C16H15FN2O5S/c17-12-3-1-2-11(8-12)9-16(21)24-10-15(20)19-13-4-6-14(7-5-13)25(18,22)23/h1-8H,9-10H2,(H,19,20)(H2,18,22,23) |
| InChIKey | ILVKIOLOOUUTCQ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |