C17H16FNO4 — CID 7840231
[2-(4-fluoroanilino)-2-oxoethyl] 2-(3-methoxyphenyl)acetate (PubChem CID 7840231) has the molecular formula C17H16FNO4 and a molecular weight of 317.32 g/mol. Its IUPAC name is [2-(4-fluoroanilino)-2-oxoethyl] 2-(3-methoxyphenyl)acetate.
| Compound Name | [2-(4-fluoroanilino)-2-oxoethyl] 2-(3-methoxyphenyl)acetate |
|---|---|
| PubChem CID | 7840231 |
| Molecular Formula | C17H16FNO4 |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | [2-(4-fluoroanilino)-2-oxoethyl] 2-(3-methoxyphenyl)acetate |
| SMILES | COc1cccc(CC(=O)OCC(=O)Nc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C17H16FNO4/c1-22-15-4-2-3-12(9-15)10-17(21)23-11-16(20)19-14-7-5-13(18)6-8-14/h2-9H,10-11H2,1H3,(H,19,20) |
| InChIKey | IYRICDNRDUPCMB-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |