C17H15ClFNO4 — CID 7834140
[2-(5-chloro-2-fluoroanilino)-2-oxoethyl] 2-(3-methoxyphenyl)acetate (PubChem CID 7834140) has the molecular formula C17H15ClFNO4 and a molecular weight of 351.76 g/mol. Its IUPAC name is [2-(5-chloro-2-fluoroanilino)-2-oxoethyl] 2-(3-methoxyphenyl)acetate.
| Compound Name | [2-(5-chloro-2-fluoroanilino)-2-oxoethyl] 2-(3-methoxyphenyl)acetate |
|---|---|
| PubChem CID | 7834140 |
| Molecular Formula | C17H15ClFNO4 |
| Molecular Weight | 351.76 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | [2-(5-chloro-2-fluoroanilino)-2-oxoethyl] 2-(3-methoxyphenyl)acetate |
| SMILES | COc1cccc(CC(=O)OCC(=O)Nc2cc(Cl)ccc2F)c1 |
| InChI | InChI=1S/C17H15ClFNO4/c1-23-13-4-2-3-11(7-13)8-17(22)24-10-16(21)20-15-9-12(18)5-6-14(15)19/h2-7,9H,8,10H2,1H3,(H,20,21) |
| InChIKey | IXTOHUFZEITMEJ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.76 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |