C16H18FN3O3S — CID 27871672
1-ethyl-1-[(3-fluorophenyl)methyl]-3-(4-sulfamoylphenyl)urea (PubChem CID 27871672) has the molecular formula C16H18FN3O3S and a molecular weight of 351.40 g/mol. Its IUPAC name is 1-ethyl-1-[(3-fluorophenyl)methyl]-3-(4-sulfamoylphenyl)urea.
| Compound Name | 1-ethyl-1-[(3-fluorophenyl)methyl]-3-(4-sulfamoylphenyl)urea |
|---|---|
| PubChem CID | 27871672 |
| Molecular Formula | C16H18FN3O3S |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | 1-ethyl-1-[(3-fluorophenyl)methyl]-3-(4-sulfamoylphenyl)urea |
| SMILES | CCN(Cc1cccc(F)c1)C(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C16H18FN3O3S/c1-2-20(11-12-4-3-5-13(17)10-12)16(21)19-14-6-8-15(9-7-14)24(18,22)23/h3-10H,2,11H2,1H3,(H,19,21)(H2,18,22,23) |
| InChIKey | VTSXPFXSXIHXQF-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |