C14H14N2O5S2 — CID 7798869
[2-oxo-2-(4-sulfamoylanilino)ethyl] 2-thiophen-2-ylacetate (PubChem CID 7798869) has the molecular formula C14H14N2O5S2 and a molecular weight of 354.41 g/mol. Its IUPAC name is [2-oxo-2-(4-sulfamoylanilino)ethyl] 2-thiophen-2-ylacetate.
| Compound Name | [2-oxo-2-(4-sulfamoylanilino)ethyl] 2-thiophen-2-ylacetate |
|---|---|
| PubChem CID | 7798869 |
| Molecular Formula | C14H14N2O5S2 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.03 |
| IUPAC Name | [2-oxo-2-(4-sulfamoylanilino)ethyl] 2-thiophen-2-ylacetate |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)COC(=O)Cc2cccs2)cc1 |
| InChI | InChI=1S/C14H14N2O5S2/c15-23(19,20)12-5-3-10(4-6-12)16-13(17)9-21-14(18)8-11-2-1-7-22-11/h1-7H,8-9H2,(H,16,17)(H2,15,19,20) |
| InChIKey | REUFFVNKBRIMPD-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |