C19H21NO5S — CID 7798928
butyl 4-[[2-(2-thiophen-2-ylacetyl)oxyacetyl]amino]benzoate (PubChem CID 7798928) has the molecular formula C19H21NO5S and a molecular weight of 375.45 g/mol. Its IUPAC name is butyl 4-[[2-(2-thiophen-2-ylacetyl)oxyacetyl]amino]benzoate.
| Compound Name | butyl 4-[[2-(2-thiophen-2-ylacetyl)oxyacetyl]amino]benzoate |
|---|---|
| PubChem CID | 7798928 |
| Molecular Formula | C19H21NO5S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | butyl 4-[[2-(2-thiophen-2-ylacetyl)oxyacetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)COC(=O)Cc2cccs2)cc1 |
| InChI | InChI=1S/C19H21NO5S/c1-2-3-10-24-19(23)14-6-8-15(9-7-14)20-17(21)13-25-18(22)12-16-5-4-11-26-16/h4-9,11H,2-3,10,12-13H2,1H3,(H,20,21) |
| InChIKey | BTBGTMAEKQTLDL-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|