C18H22N2O3S — CID 2608891
propyl 4-[[2-[methyl(thiophen-2-ylmethyl)amino]acetyl]amino]benzoate (PubChem CID 2608891) has the molecular formula C18H22N2O3S and a molecular weight of 346.45 g/mol. Its IUPAC name is propyl 4-[[2-[methyl(thiophen-2-ylmethyl)amino]acetyl]amino]benzoate.
| Compound Name | propyl 4-[[2-[methyl(thiophen-2-ylmethyl)amino]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 2608891 |
| Molecular Formula | C18H22N2O3S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | propyl 4-[[2-[methyl(thiophen-2-ylmethyl)amino]acetyl]amino]benzoate |
| SMILES | CCCOC(=O)c1ccc(NC(=O)CN(C)Cc2cccs2)cc1 |
| InChI | InChI=1S/C18H22N2O3S/c1-3-10-23-18(22)14-6-8-15(9-7-14)19-17(21)13-20(2)12-16-5-4-11-24-16/h4-9,11H,3,10,12-13H2,1-2H3,(H,19,21) |
| InChIKey | GHCNSRIZFQZKBV-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |