C20H21N3O4S — CID 38908772
propyl 4-[4-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)butanoylamino]benzoate (PubChem CID 38908772) has the molecular formula C20H21N3O4S and a molecular weight of 399.47 g/mol. Its IUPAC name is propyl 4-[4-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)butanoylamino]benzoate.
| Compound Name | propyl 4-[4-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)butanoylamino]benzoate |
|---|---|
| PubChem CID | 38908772 |
| Molecular Formula | C20H21N3O4S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | propyl 4-[4-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)butanoylamino]benzoate |
| SMILES | CCCOC(=O)c1ccc(NC(=O)CCCc2nc(-c3cccs3)no2)cc1 |
| InChI | InChI=1S/C20H21N3O4S/c1-2-12-26-20(25)14-8-10-15(11-9-14)21-17(24)6-3-7-18-22-19(23-27-18)16-5-4-13-28-16/h4-5,8-11,13H,2-3,6-7,12H2,1H3,(H,21,24) |
| InChIKey | WYVXRZQJGIWTGH-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |